C20H20F4N2O — CID 166682810
[(6-cyclopropyl-1,1,1-trifluoro-3-methylhex-5-yn-3-yl)amino]-(8-fluoroquinolin-3-yl)methanol (PubChem CID 166682810) has the molecular formula C20H20F4N2O and a molecular weight of 380.39 g/mol. Its IUPAC name is [(6-cyclopropyl-1,1,1-trifluoro-3-methylhex-5-yn-3-yl)amino]-(8-fluoroquinolin-3-yl)methanol.
| Compound Name | [(6-cyclopropyl-1,1,1-trifluoro-3-methylhex-5-yn-3-yl)amino]-(8-fluoroquinolin-3-yl)methanol |
|---|---|
| PubChem CID | 166682810 |
| Molecular Formula | C20H20F4N2O |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [(6-cyclopropyl-1,1,1-trifluoro-3-methylhex-5-yn-3-yl)amino]-(8-fluoroquinolin-3-yl)methanol |
| SMILES | CC(CC#CC1CC1)(CC(F)(F)F)NC(O)c1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C20H20F4N2O/c1-19(12-20(22,23)24,9-3-4-13-7-8-13)26-18(27)15-10-14-5-2-6-16(21)17(14)25-11-15/h2,5-6,10-11,13,18,26-27H,7-9,12H2,1H3 |
| InChIKey | DTDXZIWLINFWIR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|