C12H23NO — CID 166682850
(5E)-8-methyl-1-(2-methylpropyl)-3,4,7,8-tetrahydro-2H-azocin-3-ol (PubChem CID 166682850) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (5E)-8-methyl-1-(2-methylpropyl)-3,4,7,8-tetrahydro-2H-azocin-3-ol.
| Compound Name | (5E)-8-methyl-1-(2-methylpropyl)-3,4,7,8-tetrahydro-2H-azocin-3-ol |
|---|---|
| PubChem CID | 166682850 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (5E)-8-methyl-1-(2-methylpropyl)-3,4,7,8-tetrahydro-2H-azocin-3-ol |
| SMILES | CC(C)CN1CC(O)C/C=C\CC1C |
| InChI | InChI=1S/C12H23NO/c1-10(2)8-13-9-12(14)7-5-4-6-11(13)3/h4-5,10-12,14H,6-9H2,1-3H3/b5-4- |
| InChIKey | VFYCZMFAAXDAKG-PLNGDYQASA-N |
| XLogP | 2.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|