C35H47NO4 — CID 166683034
2-[(1R,2S,4S,5'S,6R,7S,8R,12S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]isoindole-1,3-dione (PubChem CID 166683034) has the molecular formula C35H47NO4 and a molecular weight of 545.76 g/mol. Its IUPAC name is 2-[(1R,2S,4S,5'S,6R,7S,8R,12S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2S,4S,5'S,6R,7S,8R,12S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166683034 |
| Molecular Formula | C35H47NO4 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | 2-[(1R,2S,4S,5'S,6R,7S,8R,12S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]isoindole-1,3-dione |
| SMILES | C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CCC5CC(N6C(=O)c7ccccc7C6=O)CCC5(C)[C@H]4CCC3(C)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C35H47NO4/c1-20-11-16-35(39-19-20)21(2)30-29(40-35)18-28-26-10-9-22-17-23(12-14-33(22,3)27(26)13-15-34(28,30)4)36-31(37)24-7-5-6-8-25(24)32(36)38/h5-8,20-23,26-30H,9-19H2,1-4H3/t20-,21-,22?,23?,26+,27-,28-,29-,30-,33?,34?,35+/m0/s1 |
| InChIKey | TXAXRLCAXBGOEO-FIGLCITGSA-N |
| XLogP | 7.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|