C24H29N4OP — CID 166683091
N-tert-butyl-2-(4-methyl-3-phosphanylphenyl)-6-(4-propan-2-ylpyrimidin-5-yl)pyridine-4-carboxamide (PubChem CID 166683091) has the molecular formula C24H29N4OP and a molecular weight of 420.50 g/mol. Its IUPAC name is N-tert-butyl-2-(4-methyl-3-phosphanylphenyl)-6-(4-propan-2-ylpyrimidin-5-yl)pyridine-4-carboxamide.
| Compound Name | N-tert-butyl-2-(4-methyl-3-phosphanylphenyl)-6-(4-propan-2-ylpyrimidin-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166683091 |
| Molecular Formula | C24H29N4OP |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-tert-butyl-2-(4-methyl-3-phosphanylphenyl)-6-(4-propan-2-ylpyrimidin-5-yl)pyridine-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC(C)(C)C)cc(-c3cncnc3C(C)C)n2)cc1P |
| InChI | InChI=1S/C24H29N4OP/c1-14(2)22-18(12-25-13-26-22)20-10-17(23(29)28-24(4,5)6)9-19(27-20)16-8-7-15(3)21(30)11-16/h7-14H,30H2,1-6H3,(H,28,29) |
| InChIKey | XFDAHEYDZWDPBD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|