C11H12O6S2 — CID 166683104
(E,1E)-1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-2-ene-1,3-disulfonic acid (PubChem CID 166683104) has the molecular formula C11H12O6S2 and a molecular weight of 304.35 g/mol. Its IUPAC name is (E,1E)-1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-2-ene-1,3-disulfonic acid.
| Compound Name | (E,1E)-1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-2-ene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 166683104 |
| Molecular Formula | C11H12O6S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (E,1E)-1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-2-ene-1,3-disulfonic acid |
| SMILES | C=c1cccc/c1=C(/C=C(\C)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C11H12O6S2/c1-8-5-3-4-6-10(8)11(19(15,16)17)7-9(2)18(12,13)14/h3-7H,1H2,2H3,(H,12,13,14)(H,15,16,17)/b9-7+,11-10+ |
| InChIKey | YVGMNQDAJGFWDD-RJECPTDASA-N |
| XLogP | -0.12 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|