C26H32N6O5S — CID 166683118
3-[2-amino-5-[[4-[[(2Z,4E)-4-carbamoylhepta-2,4,6-trienyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-methylphenoxy]propane-1-sulfonic acid (PubChem CID 166683118) has the molecular formula C26H32N6O5S and a molecular weight of 540.65 g/mol. Its IUPAC name is 3-[2-amino-5-[[4-[[(2Z,4E)-4-carbamoylhepta-2,4,6-trienyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-methylphenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-amino-5-[[4-[[(2Z,4E)-4-carbamoylhepta-2,4,6-trienyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-methylphenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 166683118 |
| Molecular Formula | C26H32N6O5S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 3-[2-amino-5-[[4-[[(2Z,4E)-4-carbamoylhepta-2,4,6-trienyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-methylphenoxy]propane-1-sulfonic acid |
| SMILES | C=C/C=C(\C=C/C/N=N/c1cc(C)c(/N=N/c2cc(OCCCS(=O)(=O)O)c(N)cc2C)cc1C)C(N)=O |
| InChI | InChI=1S/C26H32N6O5S/c1-5-8-20(26(28)33)9-6-10-29-30-22-14-19(4)23(15-18(22)3)31-32-24-16-25(21(27)13-17(24)2)37-11-7-12-38(34,35)36/h5-6,8-9,13-16H,1,7,10-12,27H2,2-4H3,(H2,28,33)(H,34,35,36)/b9-6-,20-8+,30-29+,32-31+ |
| InChIKey | UTERZYCMUHAVIF-SKXZFITASA-N |
| XLogP | 5.50 |
| TPSA | 182.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|