C20H24N4O — CID 16668314
3-[[11-methyl-10-(4-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]propan-1-ol (PubChem CID 16668314) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[[11-methyl-10-(4-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[11-methyl-10-(4-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 16668314 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[[11-methyl-10-(4-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]propan-1-ol |
| SMILES | Cc1ccc(-c2c(C)nn3c(NCCCO)c4c(nc23)CCC4)cc1 |
| InChI | InChI=1S/C20H24N4O/c1-13-7-9-15(10-8-13)18-14(2)23-24-19(21-11-4-12-25)16-5-3-6-17(16)22-20(18)24/h7-10,21,25H,3-6,11-12H2,1-2H3 |
| InChIKey | QWEDWFGAXDKLDM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|