C19H21FN4O — CID 16668323
2-[[10-(4-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]-methylamino]ethanol (PubChem CID 16668323) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-[[10-(4-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]-methylamino]ethanol.
| Compound Name | 2-[[10-(4-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 16668323 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-[[10-(4-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]-methylamino]ethanol |
| SMILES | Cc1nn2c(N(C)CCO)c3c(nc2c1-c1ccc(F)cc1)CCC3 |
| InChI | InChI=1S/C19H21FN4O/c1-12-17(13-6-8-14(20)9-7-13)18-21-16-5-3-4-15(16)19(24(18)22-12)23(2)10-11-25/h6-9,25H,3-5,10-11H2,1-2H3 |
| InChIKey | NLBAJKHYVVROCB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |