C21H34N2O — CID 166683841
N-[2-(1-butan-2-ylpiperidin-4-yl)ethyl]-4-propan-2-ylbenzamide (PubChem CID 166683841) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is N-[2-(1-butan-2-ylpiperidin-4-yl)ethyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[2-(1-butan-2-ylpiperidin-4-yl)ethyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 166683841 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | N-[2-(1-butan-2-ylpiperidin-4-yl)ethyl]-4-propan-2-ylbenzamide |
| SMILES | CCC(C)N1CCC(CCNC(=O)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H34N2O/c1-5-17(4)23-14-11-18(12-15-23)10-13-22-21(24)20-8-6-19(7-9-20)16(2)3/h6-9,16-18H,5,10-15H2,1-4H3,(H,22,24) |
| InChIKey | KLKIQMQAFPVXQQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |