About 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde
7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde (PubChem CID 166684150) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde.
Molecular Properties
| Compound Name | 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde |
| PubChem CID | 166684150 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde |
| SMILES | CN(C)NC1CCN(C=O)CCO1 |
| InChI | InChI=1S/C8H17N3O2/c1-10(2)9-8-3-4-11(7-12)5-6-13-8/h7-9H,3-6H2,1-2H3 |
| InChIKey | NUYXWMMGMIPUMZ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde?
The IUPAC name of 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde (CID 166684150) is 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde.
What is the SMILES notation for 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde?
The canonical SMILES for 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde is CN(C)NC1CCN(C=O)CCO1.
What is the InChIKey of 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde?
The InChIKey is NUYXWMMGMIPUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-10(2)9-8-3-4-11(7-12)5-6-13-8/h7-9H,3-6H2,1-2H3.
What are the key properties of 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde?
7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde has a molecular weight of 187.24 g/mol, XLogP of -0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-dimethylhydrazinyl)-1,4-oxazepane-4-carbaldehyde is sourced from PubChem (CID 166684150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).