C16H30O2S — CID 166684232
4-[(1R)-3,4-dimethylcyclohexyl]sulfonyl-1,2-dimethylcyclohexane (PubChem CID 166684232) has the molecular formula C16H30O2S and a molecular weight of 286.48 g/mol. Its IUPAC name is 4-[(1R)-3,4-dimethylcyclohexyl]sulfonyl-1,2-dimethylcyclohexane.
| Compound Name | 4-[(1R)-3,4-dimethylcyclohexyl]sulfonyl-1,2-dimethylcyclohexane |
|---|---|
| PubChem CID | 166684232 |
| Molecular Formula | C16H30O2S |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-[(1R)-3,4-dimethylcyclohexyl]sulfonyl-1,2-dimethylcyclohexane |
| SMILES | CC1CCC(S(=O)(=O)[C@@H]2CCC(C)C(C)C2)CC1C |
| InChI | InChI=1S/C16H30O2S/c1-11-5-7-15(9-13(11)3)19(17,18)16-8-6-12(2)14(4)10-16/h11-16H,5-10H2,1-4H3/t11?,12?,13?,14?,15-,16?/m1/s1 |
| InChIKey | XXOWUWLAJFYCQS-BAPHQMLMSA-N |
| XLogP | 4.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |