C7H15NO3S — CID 166684315
(2S,3R)-3-amino-2-methoxy-5-methylsulfanylpentanoic acid (PubChem CID 166684315) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is (2S,3R)-3-amino-2-methoxy-5-methylsulfanylpentanoic acid.
| Compound Name | (2S,3R)-3-amino-2-methoxy-5-methylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 166684315 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | (2S,3R)-3-amino-2-methoxy-5-methylsulfanylpentanoic acid |
| SMILES | CO[C@H](C(=O)O)[C@H](N)CCSC |
| InChI | InChI=1S/C7H15NO3S/c1-11-6(7(9)10)5(8)3-4-12-2/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | GWLUQMYAGQLFLD-RITPCOANSA-N |
| XLogP | 0.17 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |