C13H26N2 — CID 166684445
7-(aminomethyl)-2,2,5-trimethyl-1,3,3a,4,5,6,7,7a-octahydroinden-4-amine (PubChem CID 166684445) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 7-(aminomethyl)-2,2,5-trimethyl-1,3,3a,4,5,6,7,7a-octahydroinden-4-amine.
| Compound Name | 7-(aminomethyl)-2,2,5-trimethyl-1,3,3a,4,5,6,7,7a-octahydroinden-4-amine |
|---|---|
| PubChem CID | 166684445 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 7-(aminomethyl)-2,2,5-trimethyl-1,3,3a,4,5,6,7,7a-octahydroinden-4-amine |
| SMILES | CC1CC(CN)C2CC(C)(C)CC2C1N |
| InChI | InChI=1S/C13H26N2/c1-8-4-9(7-14)10-5-13(2,3)6-11(10)12(8)15/h8-12H,4-7,14-15H2,1-3H3 |
| InChIKey | MNZVHYJPFPXITB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |