C16H29NO — CID 166684529
5,5-dimethyl-1-propan-2-ylspiro[4,4a,6,7,8,8a-hexahydro-3H-quinoline-2,3'-oxetane] (PubChem CID 166684529) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 5,5-dimethyl-1-propan-2-ylspiro[4,4a,6,7,8,8a-hexahydro-3H-quinoline-2,3'-oxetane].
| Compound Name | 5,5-dimethyl-1-propan-2-ylspiro[4,4a,6,7,8,8a-hexahydro-3H-quinoline-2,3'-oxetane] |
|---|---|
| PubChem CID | 166684529 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 5,5-dimethyl-1-propan-2-ylspiro[4,4a,6,7,8,8a-hexahydro-3H-quinoline-2,3'-oxetane] |
| SMILES | CC(C)N1C2CCCC(C)(C)C2CCC12COC2 |
| InChI | InChI=1S/C16H29NO/c1-12(2)17-14-6-5-8-15(3,4)13(14)7-9-16(17)10-18-11-16/h12-14H,5-11H2,1-4H3 |
| InChIKey | YOWMANAAPNSMRE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |