C26H31N7O2 — CID 166685035
4-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]-1-methyl-3-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 166685035) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]-1-methyl-3-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 4-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]-1-methyl-3-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 166685035 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 4-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]-1-methyl-3-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | COCCOc1cc(C)c(-c2nc(N)nc3c2c(Nc2ccc4c(c2)CNCC4)nn3C)c(C)c1 |
| InChI | InChI=1S/C26H31N7O2/c1-15-11-20(35-10-9-34-4)12-16(2)21(15)23-22-24(32-33(3)25(22)31-26(27)30-23)29-19-6-5-17-7-8-28-14-18(17)13-19/h5-6,11-13,28H,7-10,14H2,1-4H3,(H,29,32)(H2,27,30,31) |
| InChIKey | UCFBZRISHVWSRP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|