C25H41N3 — CID 166685330
(2Z,8Z,10E)-11-cyclohexyl-4-ethylimino-6,6-dimethyl-3-(methylideneamino)-8-[(Z)-prop-1-enyl]undeca-2,8,10-trien-2-amine (PubChem CID 166685330) has the molecular formula C25H41N3 and a molecular weight of 383.62 g/mol. Its IUPAC name is (2Z,8Z,10E)-11-cyclohexyl-4-ethylimino-6,6-dimethyl-3-(methylideneamino)-8-[(Z)-prop-1-enyl]undeca-2,8,10-trien-2-amine.
| Compound Name | (2Z,8Z,10E)-11-cyclohexyl-4-ethylimino-6,6-dimethyl-3-(methylideneamino)-8-[(Z)-prop-1-enyl]undeca-2,8,10-trien-2-amine |
|---|---|
| PubChem CID | 166685330 |
| Molecular Formula | C25H41N3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.33 |
| IUPAC Name | (2Z,8Z,10E)-11-cyclohexyl-4-ethylimino-6,6-dimethyl-3-(methylideneamino)-8-[(Z)-prop-1-enyl]undeca-2,8,10-trien-2-amine |
| SMILES | C=NC(/C(CC(C)(C)CC(/C=C\C)=C/C=C/C1CCCCC1)=N\CC)=C(/C)N |
| InChI | InChI=1S/C25H41N3/c1-7-13-22(17-12-16-21-14-10-9-11-15-21)18-25(4,5)19-23(28-8-2)24(27-6)20(3)26/h7,12-13,16-17,21H,6,8-11,14-15,18-19,26H2,1-5H3/b13-7-,16-12+,22-17+,24-20-,28-23- |
| InChIKey | IUQVJVYUVBLVAS-ZVJWRBIPSA-N |
| XLogP | 6.78 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|