C15H13FN2O4 — CID 166685882
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-5-methylcyclohepta[c]pyrrole-1,3-dione (PubChem CID 166685882) has the molecular formula C15H13FN2O4 and a molecular weight of 304.28 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-5-methylcyclohepta[c]pyrrole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-5-methylcyclohepta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 166685882 |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-5-methylcyclohepta[c]pyrrole-1,3-dione |
| SMILES | CC1(F)C=CC=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=C1 |
| InChI | InChI=1S/C15H13FN2O4/c1-15(16)6-2-3-8-9(7-15)14(22)18(13(8)21)10-4-5-11(19)17-12(10)20/h2-3,6-7,10H,4-5H2,1H3,(H,17,19,20) |
| InChIKey | BPPSPDWWAGUVLW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|