C9H17FN2O — CID 166686001
9-fluoro-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 166686001) has the molecular formula C9H17FN2O and a molecular weight of 188.25 g/mol. Its IUPAC name is 9-fluoro-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | 9-fluoro-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 166686001 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 9-fluoro-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | CN1CCOC2(CCN(F)CC2)C1 |
| InChI | InChI=1S/C9H17FN2O/c1-11-6-7-13-9(8-11)2-4-12(10)5-3-9/h2-8H2,1H3 |
| InChIKey | RHKORPCEGSLJFX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|