C40H30N12 — CID 166686737
2-[3,5-bis(3-phenylimidazo[4,5-b]pyrazin-2-yl)phenyl]-3-[(2Z,4E)-hepta-2,4-dien-4-yl]imidazo[4,5-b]pyrazine (PubChem CID 166686737) has the molecular formula C40H30N12 and a molecular weight of 678.76 g/mol. Its IUPAC name is 2-[3,5-bis(3-phenylimidazo[4,5-b]pyrazin-2-yl)phenyl]-3-[(2Z,4E)-hepta-2,4-dien-4-yl]imidazo[4,5-b]pyrazine.
| Compound Name | 2-[3,5-bis(3-phenylimidazo[4,5-b]pyrazin-2-yl)phenyl]-3-[(2Z,4E)-hepta-2,4-dien-4-yl]imidazo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 166686737 |
| Molecular Formula | C40H30N12 |
| Molecular Weight | 678.76 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | 2-[3,5-bis(3-phenylimidazo[4,5-b]pyrazin-2-yl)phenyl]-3-[(2Z,4E)-hepta-2,4-dien-4-yl]imidazo[4,5-b]pyrazine |
| SMILES | C/C=C\C(=C/CC)n1c(-c2cc(-c3nc4nccnc4n3-c3ccccc3)cc(-c3nc4nccnc4n3-c3ccccc3)c2)nc2nccnc21 |
| InChI | InChI=1S/C40H30N12/c1-3-11-29(12-4-2)50-35(47-32-38(50)44-20-17-41-32)26-23-27(36-48-33-39(45-21-18-42-33)51(36)30-13-7-5-8-14-30)25-28(24-26)37-49-34-40(46-22-19-43-34)52(37)31-15-9-6-10-16-31/h3,5-25H,4H2,1-2H3/b11-3-,29-12+ |
| InChIKey | FNDOMPUJFCMASZ-MRSDTCMUSA-N |
| XLogP | 7.91 |
| TPSA | 130.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.76 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|