About 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene
1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene (PubChem CID 166687043) has the molecular formula C11H16F2O2
and a molecular weight of 218.24 g/mol. Its IUPAC name is 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene |
| PubChem CID | 166687043 |
| Molecular Formula | C11H16F2O2 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene |
| SMILES | COC1(C)C=CC=C1OCCCC(F)F |
| InChI | InChI=1S/C11H16F2O2/c1-11(14-2)7-3-5-9(11)15-8-4-6-10(12)13/h3,5,7,10H,4,6,8H2,1-2H3 |
| InChIKey | VBXVABUWYYNVID-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene?
The IUPAC name of 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene (CID 166687043) is 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene.
What is the SMILES notation for 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene?
The canonical SMILES for 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene is COC1(C)C=CC=C1OCCCC(F)F.
What is the InChIKey of 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene?
The InChIKey is VBXVABUWYYNVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2O2/c1-11(14-2)7-3-5-9(11)15-8-4-6-10(12)13/h3,5,7,10H,4,6,8H2,1-2H3.
What are the key properties of 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene?
1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene has a molecular weight of 218.24 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorobutoxy)-5-methoxy-5-methylcyclopenta-1,3-diene is sourced from PubChem (CID 166687043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).