C14H31NS — CID 166687282
(3S,4R)-N,N,2,5,6-pentamethyl-3-methylsulfanyloctan-4-amine (PubChem CID 166687282) has the molecular formula C14H31NS and a molecular weight of 245.48 g/mol. Its IUPAC name is (3S,4R)-N,N,2,5,6-pentamethyl-3-methylsulfanyloctan-4-amine.
| Compound Name | (3S,4R)-N,N,2,5,6-pentamethyl-3-methylsulfanyloctan-4-amine |
|---|---|
| PubChem CID | 166687282 |
| Molecular Formula | C14H31NS |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | (3S,4R)-N,N,2,5,6-pentamethyl-3-methylsulfanyloctan-4-amine |
| SMILES | CCC(C)C(C)[C@H]([C@@H](SC)C(C)C)N(C)C |
| InChI | InChI=1S/C14H31NS/c1-9-11(4)12(5)13(15(6)7)14(16-8)10(2)3/h10-14H,9H2,1-8H3/t11?,12?,13-,14+/m1/s1 |
| InChIKey | OTECOUAYEKFSPY-PQAZSJQKSA-N |
| XLogP | 3.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |