About 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine
2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine (PubChem CID 166687652) has the molecular formula C12H12ClFN2
and a molecular weight of 238.69 g/mol. Its IUPAC name is 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine.
Molecular Properties
| Compound Name | 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine |
| PubChem CID | 166687652 |
| Molecular Formula | C12H12ClFN2 |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine |
| SMILES | C=C/C=C(\C=C(\F)CCl)Cc1ncccn1 |
| InChI | InChI=1S/C12H12ClFN2/c1-2-4-10(7-11(14)9-13)8-12-15-5-3-6-16-12/h2-7H,1,8-9H2/b10-4+,11-7+ |
| InChIKey | FCHYATBQYHUCHO-ATTFBSEUSA-N |
| XLogP | 3.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine?
The IUPAC name of 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine (CID 166687652) is 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine.
What is the SMILES notation for 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine?
The canonical SMILES for 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine is C=C/C=C(\C=C(\F)CCl)Cc1ncccn1.
What is the InChIKey of 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine?
The InChIKey is FCHYATBQYHUCHO-ATTFBSEUSA-N. The full InChI is InChI=1S/C12H12ClFN2/c1-2-4-10(7-11(14)9-13)8-12-15-5-3-6-16-12/h2-7H,1,8-9H2/b10-4+,11-7+.
What are the key properties of 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine?
2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine has a molecular weight of 238.69 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z)-2-[(E)-3-chloro-2-fluoroprop-1-enyl]penta-2,4-dienyl]pyrimidine is sourced from PubChem (CID 166687652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).