About (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate
(2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate (PubChem CID 166687872) has the molecular formula C18H17ClN4O3
and a molecular weight of 372.81 g/mol. Its IUPAC name is (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate.
Molecular Properties
| Compound Name | (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate |
| PubChem CID | 166687872 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate |
| SMILES | CCc1ccc(OC(=O)Cn2cc(-c3cc(=O)[nH]c(C)n3)cn2)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClN4O3/c1-3-12-4-5-16(14(19)6-12)26-18(25)10-23-9-13(8-20-23)15-7-17(24)22-11(2)21-15/h4-9H,3,10H2,1-2H3,(H,21,22,24) |
| InChIKey | HQPDAWSHTLXJNH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate?
The IUPAC name of (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate (CID 166687872) is (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate.
What is the SMILES notation for (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate?
The canonical SMILES for (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate is CCc1ccc(OC(=O)Cn2cc(-c3cc(=O)[nH]c(C)n3)cn2)c(Cl)c1.
What is the InChIKey of (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate?
The InChIKey is HQPDAWSHTLXJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN4O3/c1-3-12-4-5-16(14(19)6-12)26-18(25)10-23-9-13(8-20-23)15-7-17(24)22-11(2)21-15/h4-9H,3,10H2,1-2H3,(H,21,22,24).
What are the key properties of (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate?
(2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate has a molecular weight of 372.81 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-ethylphenyl) 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)pyrazol-1-yl]acetate is sourced from PubChem (CID 166687872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).