About 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine
2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine (PubChem CID 166688891) has the molecular formula C15H35N3O
and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine.
Molecular Properties
| Compound Name | 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine |
| PubChem CID | 166688891 |
| Molecular Formula | C15H35N3O |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.28 |
| IUPAC Name | 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine |
| SMILES | CNC(CN)C(C)NCCC(C)(C)OCCC(C)C |
| InChI | InChI=1S/C15H35N3O/c1-12(2)7-10-19-15(4,5)8-9-18-13(3)14(11-16)17-6/h12-14,17-18H,7-11,16H2,1-6H3 |
| InChIKey | AVCBIAKXEWJJKW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine?
The IUPAC name of 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine (CID 166688891) is 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine.
What is the SMILES notation for 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine?
The canonical SMILES for 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine is CNC(CN)C(C)NCCC(C)(C)OCCC(C)C.
What is the InChIKey of 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine?
The InChIKey is AVCBIAKXEWJJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H35N3O/c1-12(2)7-10-19-15(4,5)8-9-18-13(3)14(11-16)17-6/h12-14,17-18H,7-11,16H2,1-6H3.
What are the key properties of 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine?
2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine has a molecular weight of 273.46 g/mol, XLogP of 1.74, 11 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methyl-3-N-[3-methyl-3-(3-methylbutoxy)butyl]butane-1,2,3-triamine is sourced from PubChem (CID 166688891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).