C17H26FN3 — CID 166689126
N,N-diethyl-4-[(1E,3Z)-3-(1-fluoroethyl)-2-methylhexa-1,3,5-trienyl]-1-methylpyrazol-3-amine (PubChem CID 166689126) has the molecular formula C17H26FN3 and a molecular weight of 291.41 g/mol. Its IUPAC name is N,N-diethyl-4-[(1E,3Z)-3-(1-fluoroethyl)-2-methylhexa-1,3,5-trienyl]-1-methylpyrazol-3-amine.
| Compound Name | N,N-diethyl-4-[(1E,3Z)-3-(1-fluoroethyl)-2-methylhexa-1,3,5-trienyl]-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 166689126 |
| Molecular Formula | C17H26FN3 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | N,N-diethyl-4-[(1E,3Z)-3-(1-fluoroethyl)-2-methylhexa-1,3,5-trienyl]-1-methylpyrazol-3-amine |
| SMILES | C=C/C=C(C(/C)=C/c1cn(C)nc1N(CC)CC)\C(C)F |
| InChI | InChI=1S/C17H26FN3/c1-7-10-16(14(5)18)13(4)11-15-12-20(6)19-17(15)21(8-2)9-3/h7,10-12,14H,1,8-9H2,2-6H3/b13-11+,16-10- |
| InChIKey | ACNDLSCYUIGSLI-LKXMLDOOSA-N |
| XLogP | 4.14 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|