C11H20N2 — CID 166689436
(2R,3E,5Z)-2-ethyl-5-methanimidoyl-N-methylhepta-3,5-dien-1-amine (PubChem CID 166689436) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is (2R,3E,5Z)-2-ethyl-5-methanimidoyl-N-methylhepta-3,5-dien-1-amine.
| Compound Name | (2R,3E,5Z)-2-ethyl-5-methanimidoyl-N-methylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 166689436 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (2R,3E,5Z)-2-ethyl-5-methanimidoyl-N-methylhepta-3,5-dien-1-amine |
| SMILES | [H]/N=C/C(=C\C)/C=C/[C@@H](CC)CNC |
| InChI | InChI=1S/C11H20N2/c1-4-10(8-12)6-7-11(5-2)9-13-3/h4,6-8,11-13H,5,9H2,1-3H3/b7-6+,10-4-,12-8+/t11-/m1/s1 |
| InChIKey | FCKPCZBIVVJBET-MNFPSMRASA-N |
| XLogP | 2.38 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|