About (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine
(5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine (PubChem CID 166689655) has the molecular formula C8H10FN
and a molecular weight of 139.17 g/mol. Its IUPAC name is (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine.
Molecular Properties
| Compound Name | (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine |
| PubChem CID | 166689655 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine |
| SMILES | C/C1=N/C=C(F)\C=C/CC1 |
| InChI | InChI=1S/C8H10FN/c1-7-4-2-3-5-8(9)6-10-7/h3,5-6H,2,4H2,1H3/b5-3-,8-6+,10-7- |
| InChIKey | STJBAZGDTXTYDY-OXCXNJLASA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine?
The IUPAC name of (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine (CID 166689655) is (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine.
What is the SMILES notation for (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine?
The canonical SMILES for (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine is C/C1=N/C=C(F)\C=C/CC1.
What is the InChIKey of (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine?
The InChIKey is STJBAZGDTXTYDY-OXCXNJLASA-N. The full InChI is InChI=1S/C8H10FN/c1-7-4-2-3-5-8(9)6-10-7/h3,5-6H,2,4H2,1H3/b5-3-,8-6+,10-7-.
What are the key properties of (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine?
(5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine has a molecular weight of 139.17 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7E)-7-fluoro-2-methyl-3,4-dihydroazocine is sourced from PubChem (CID 166689655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).