C21H16N2O3S — CID 166690718
8-ethyl-2-(3-methyl-1-benzothiophen-2-yl)-5-nitrosoquinoline-4-carboxylic acid (PubChem CID 166690718) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is 8-ethyl-2-(3-methyl-1-benzothiophen-2-yl)-5-nitrosoquinoline-4-carboxylic acid.
| Compound Name | 8-ethyl-2-(3-methyl-1-benzothiophen-2-yl)-5-nitrosoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 166690718 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 8-ethyl-2-(3-methyl-1-benzothiophen-2-yl)-5-nitrosoquinoline-4-carboxylic acid |
| SMILES | CCc1ccc(N=O)c2c(C(=O)O)cc(-c3sc4ccccc4c3C)nc12 |
| InChI | InChI=1S/C21H16N2O3S/c1-3-12-8-9-15(23-26)18-14(21(24)25)10-16(22-19(12)18)20-11(2)13-6-4-5-7-17(13)27-20/h4-10H,3H2,1-2H3,(H,24,25) |
| InChIKey | NASVLGYIDQIXLL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |