C37H51FN6O3 — CID 166690912
[2-[[1-[1-[(4-fluorophenyl)methyl]-5,6-dihydrobenzimidazol-2-yl]piperidin-4-yl]-methylamino]-6-oxopyrimidin-1-yl]methyl 2,2,3,3,5,5-hexamethylhexanoate (PubChem CID 166690912) has the molecular formula C37H51FN6O3 and a molecular weight of 646.85 g/mol. Its IUPAC name is [2-[[1-[1-[(4-fluorophenyl)methyl]-5,6-dihydrobenzimidazol-2-yl]piperidin-4-yl]-methylamino]-6-oxopyrimidin-1-yl]methyl 2,2,3,3,5,5-hexamethylhexanoate.
| Compound Name | [2-[[1-[1-[(4-fluorophenyl)methyl]-5,6-dihydrobenzimidazol-2-yl]piperidin-4-yl]-methylamino]-6-oxopyrimidin-1-yl]methyl 2,2,3,3,5,5-hexamethylhexanoate |
|---|---|
| PubChem CID | 166690912 |
| Molecular Formula | C37H51FN6O3 |
| Molecular Weight | 646.85 g/mol |
| Exact Mass | 646.40 |
| IUPAC Name | [2-[[1-[1-[(4-fluorophenyl)methyl]-5,6-dihydrobenzimidazol-2-yl]piperidin-4-yl]-methylamino]-6-oxopyrimidin-1-yl]methyl 2,2,3,3,5,5-hexamethylhexanoate |
| SMILES | CN(c1nccc(=O)n1COC(=O)C(C)(C)C(C)(C)CC(C)(C)C)C1CCN(c2nc3c(n2Cc2ccc(F)cc2)=CCCC=3)CC1 |
| InChI | InChI=1S/C37H51FN6O3/c1-35(2,3)24-36(4,5)37(6,7)32(46)47-25-44-31(45)17-20-39-33(44)41(8)28-18-21-42(22-19-28)34-40-29-11-9-10-12-30(29)43(34)23-26-13-15-27(38)16-14-26/h11-17,20,28H,9-10,18-19,21-25H2,1-8H3 |
| InChIKey | XDNBPLQRJVKOEL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 85.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |