C14H16N2 — CID 166691198
2,3,5,6-tetrakis(ethenyl)-7-methyl-1H-1,4-diazepine (PubChem CID 166691198) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(ethenyl)-7-methyl-1H-1,4-diazepine.
| Compound Name | 2,3,5,6-tetrakis(ethenyl)-7-methyl-1H-1,4-diazepine |
|---|---|
| PubChem CID | 166691198 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2,3,5,6-tetrakis(ethenyl)-7-methyl-1H-1,4-diazepine |
| SMILES | C=CC1=NC(C=C)=C(C=C)NC(C)=C1C=C |
| InChI | InChI=1S/C14H16N2/c1-6-11-10(5)15-13(8-3)14(9-4)16-12(11)7-2/h6-9,15H,1-4H2,5H3 |
| InChIKey | IJIAPXCNMJEEOE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |