About azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate
azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate (PubChem CID 166691348) has the molecular formula C16H19F2NO3
and a molecular weight of 311.33 g/mol. Its IUPAC name is azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate.
Molecular Properties
| Compound Name | azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate |
| PubChem CID | 166691348 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate |
| SMILES | CC(C)c1ccccc1C(C=O)C(F)(F)C(=O)ON1CCC1 |
| InChI | InChI=1S/C16H19F2NO3/c1-11(2)12-6-3-4-7-13(12)14(10-20)16(17,18)15(21)22-19-8-5-9-19/h3-4,6-7,10-11,14H,5,8-9H2,1-2H3 |
| InChIKey | YHDXPFXAYRGPDW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate?
The IUPAC name of azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate (CID 166691348) is azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate.
What is the SMILES notation for azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate?
The canonical SMILES for azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate is CC(C)c1ccccc1C(C=O)C(F)(F)C(=O)ON1CCC1.
What is the InChIKey of azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate?
The InChIKey is YHDXPFXAYRGPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2NO3/c1-11(2)12-6-3-4-7-13(12)14(10-20)16(17,18)15(21)22-19-8-5-9-19/h3-4,6-7,10-11,14H,5,8-9H2,1-2H3.
What are the key properties of azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate?
azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate has a molecular weight of 311.33 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-1-yl 2,2-difluoro-4-oxo-3-(2-propan-2-ylphenyl)butanoate is sourced from PubChem (CID 166691348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).