C30H47N3 — CID 166691469
N'-[3-cyclohexyl-3-[1-(3,7-dimethylocta-2,6-dienyl)indol-3-yl]propyl]propane-1,3-diamine (PubChem CID 166691469) has the molecular formula C30H47N3 and a molecular weight of 449.73 g/mol. Its IUPAC name is N'-[3-cyclohexyl-3-[1-(3,7-dimethylocta-2,6-dienyl)indol-3-yl]propyl]propane-1,3-diamine.
| Compound Name | N'-[3-cyclohexyl-3-[1-(3,7-dimethylocta-2,6-dienyl)indol-3-yl]propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 166691469 |
| Molecular Formula | C30H47N3 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 449.38 |
| IUPAC Name | N'-[3-cyclohexyl-3-[1-(3,7-dimethylocta-2,6-dienyl)indol-3-yl]propyl]propane-1,3-diamine |
| SMILES | CC(C)=CCCC(C)=CCn1cc(C(CCNCCCN)C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C30H47N3/c1-24(2)11-9-12-25(3)18-22-33-23-29(28-15-7-8-16-30(28)33)27(17-21-32-20-10-19-31)26-13-5-4-6-14-26/h7-8,11,15-16,18,23,26-27,32H,4-6,9-10,12-14,17,19-22,31H2,1-3H3 |
| InChIKey | PXMAHFHOHOULSY-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|