C19H21N3O5 — CID 166691810
N-[2-oxo-2-[[1-oxo-3-(3-oxopiperidin-4-yl)propan-2-yl]amino]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 166691810) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-[2-oxo-2-[[1-oxo-3-(3-oxopiperidin-4-yl)propan-2-yl]amino]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-oxo-2-[[1-oxo-3-(3-oxopiperidin-4-yl)propan-2-yl]amino]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 166691810 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[2-oxo-2-[[1-oxo-3-(3-oxopiperidin-4-yl)propan-2-yl]amino]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=CC(CC1CCNCC1=O)NC(=O)CNC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H21N3O5/c23-11-14(7-12-5-6-20-9-15(12)24)22-18(25)10-21-19(26)17-8-13-3-1-2-4-16(13)27-17/h1-4,8,11-12,14,20H,5-7,9-10H2,(H,21,26)(H,22,25) |
| InChIKey | NGDMIUIIQFUYIM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|