C16H20F2N2O — CID 166691871
(2R)-2-fluoro-3-[(3R)-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol (PubChem CID 166691871) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is (2R)-2-fluoro-3-[(3R)-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol.
| Compound Name | (2R)-2-fluoro-3-[(3R)-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 166691871 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2R)-2-fluoro-3-[(3R)-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3cc(F)ccc23)CN1C[C@@](C)(F)CO |
| InChI | InChI=1S/C16H20F2N2O/c1-10-5-13-12-4-3-11(17)6-14(12)19-15(13)7-20(10)8-16(2,18)9-21/h3-4,6,10,19,21H,5,7-9H2,1-2H3/t10-,16-/m1/s1 |
| InChIKey | BOIYMBKAVFETLW-QLJPJBMISA-N |
| XLogP | 2.77 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|