C22H39N5O10 — CID 166692391
N-[(1S,2R,3R,4R,5S)-1-[2-[2-[2-[2-[4-(2-aminoethoxymethyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]ethoxymethyl]-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 166692391) has the molecular formula C22H39N5O10 and a molecular weight of 533.58 g/mol. Its IUPAC name is N-[(1S,2R,3R,4R,5S)-1-[2-[2-[2-[2-[4-(2-aminoethoxymethyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]ethoxymethyl]-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,2R,3R,4R,5S)-1-[2-[2-[2-[2-[4-(2-aminoethoxymethyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]ethoxymethyl]-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 166692391 |
| Molecular Formula | C22H39N5O10 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | N-[(1S,2R,3R,4R,5S)-1-[2-[2-[2-[2-[4-(2-aminoethoxymethyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]ethoxymethyl]-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H]2OC[C@](COCCOCCOCCOCCn3cc(COCCN)nn3)(O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H39N5O10/c1-16(28)24-18-19(29)20(30)22(15-36-21(18)37-22)14-35-11-10-33-9-8-32-7-6-31-5-3-27-12-17(25-26-27)13-34-4-2-23/h12,18-21,29-30H,2-11,13-15,23H2,1H3,(H,24,28)/t18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | YQMJLOVHRRFCCZ-YXIAPDDASA-N |
| XLogP | -2.83 |
| TPSA | 190.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|