About 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine
1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine (PubChem CID 166694624) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine |
| PubChem CID | 166694624 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine |
| SMILES | CC/C1=N/CC=C(CNC)/C=C\C1 |
| InChI | InChI=1S/C11H18N2/c1-3-11-6-4-5-10(9-12-2)7-8-13-11/h4-5,7,12H,3,6,8-9H2,1-2H3/b5-4-,10-7?,13-11- |
| InChIKey | MUXGIUYUQVSBLK-RTZVFLIQSA-N |
| XLogP | 1.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine?
The IUPAC name of 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine (CID 166694624) is 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine?
The canonical SMILES for 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine is CC/C1=N/CC=C(CNC)/C=C\C1.
What is the InChIKey of 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine?
The InChIKey is MUXGIUYUQVSBLK-RTZVFLIQSA-N. The full InChI is InChI=1S/C11H18N2/c1-3-11-6-4-5-10(9-12-2)7-8-13-11/h4-5,7,12H,3,6,8-9H2,1-2H3/b5-4-,10-7?,13-11-.
What are the key properties of 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine?
1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine has a molecular weight of 178.28 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5Z)-8-ethyl-2,7-dihydroazocin-4-yl]-N-methylmethanamine is sourced from PubChem (CID 166694624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).