C18H11IO — CID 166694702
1-iodo-2-phenyldibenzofuran (PubChem CID 166694702) has the molecular formula C18H11IO and a molecular weight of 370.19 g/mol. Its IUPAC name is 1-iodo-2-phenyldibenzofuran.
| Compound Name | 1-iodo-2-phenyldibenzofuran |
|---|---|
| PubChem CID | 166694702 |
| Molecular Formula | C18H11IO |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 1-iodo-2-phenyldibenzofuran |
| SMILES | Ic1c(-c2ccccc2)ccc2oc3ccccc3c12 |
| InChI | InChI=1S/C18H11IO/c19-18-13(12-6-2-1-3-7-12)10-11-16-17(18)14-8-4-5-9-15(14)20-16/h1-11H |
| InChIKey | OJJQDOJPLXLLGN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|