C11H24F2N2 — CID 166694885
1-N-ethyl-2,2-difluoro-1-N,6-dimethylheptane-1,3-diamine (PubChem CID 166694885) has the molecular formula C11H24F2N2 and a molecular weight of 222.32 g/mol. Its IUPAC name is 1-N-ethyl-2,2-difluoro-1-N,6-dimethylheptane-1,3-diamine.
| Compound Name | 1-N-ethyl-2,2-difluoro-1-N,6-dimethylheptane-1,3-diamine |
|---|---|
| PubChem CID | 166694885 |
| Molecular Formula | C11H24F2N2 |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | 1-N-ethyl-2,2-difluoro-1-N,6-dimethylheptane-1,3-diamine |
| SMILES | CCN(C)CC(F)(F)C(N)CCC(C)C |
| InChI | InChI=1S/C11H24F2N2/c1-5-15(4)8-11(12,13)10(14)7-6-9(2)3/h9-10H,5-8,14H2,1-4H3 |
| InChIKey | IRTOHOTXZSXPPM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |