About 2-bromo-3,4-bis(ethenyl)aniline
2-bromo-3,4-bis(ethenyl)aniline (PubChem CID 166695071) has the molecular formula C10H10BrN
and a molecular weight of 224.10 g/mol. Its IUPAC name is 2-bromo-3,4-bis(ethenyl)aniline.
Molecular Properties
| Compound Name | 2-bromo-3,4-bis(ethenyl)aniline |
| PubChem CID | 166695071 |
| Molecular Formula | C10H10BrN |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 2-bromo-3,4-bis(ethenyl)aniline |
| SMILES | C=Cc1ccc(N)c(Br)c1C=C |
| InChI | InChI=1S/C10H10BrN/c1-3-7-5-6-9(12)10(11)8(7)4-2/h3-6H,1-2,12H2 |
| InChIKey | JHVOTUSAWRIFMJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3,4-bis(ethenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,4-bis(ethenyl)aniline?
The IUPAC name of 2-bromo-3,4-bis(ethenyl)aniline (CID 166695071) is 2-bromo-3,4-bis(ethenyl)aniline.
What is the SMILES notation for 2-bromo-3,4-bis(ethenyl)aniline?
The canonical SMILES for 2-bromo-3,4-bis(ethenyl)aniline is C=Cc1ccc(N)c(Br)c1C=C.
What is the InChIKey of 2-bromo-3,4-bis(ethenyl)aniline?
The InChIKey is JHVOTUSAWRIFMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN/c1-3-7-5-6-9(12)10(11)8(7)4-2/h3-6H,1-2,12H2.
What are the key properties of 2-bromo-3,4-bis(ethenyl)aniline?
2-bromo-3,4-bis(ethenyl)aniline has a molecular weight of 224.10 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,4-bis(ethenyl)aniline is sourced from PubChem (CID 166695071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).