C12H18FNO2 — CID 166695212
(2E,4Z)-4-fluoro-5-methyl-2-[(E)-1-(methylamino)prop-1-enyl]hepta-2,4-dienoic acid (PubChem CID 166695212) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is (2E,4Z)-4-fluoro-5-methyl-2-[(E)-1-(methylamino)prop-1-enyl]hepta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-4-fluoro-5-methyl-2-[(E)-1-(methylamino)prop-1-enyl]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 166695212 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (2E,4Z)-4-fluoro-5-methyl-2-[(E)-1-(methylamino)prop-1-enyl]hepta-2,4-dienoic acid |
| SMILES | C/C=C(NC)\C(=C/C(F)=C(\C)CC)C(=O)O |
| InChI | InChI=1S/C12H18FNO2/c1-5-8(3)10(13)7-9(12(15)16)11(6-2)14-4/h6-7,14H,5H2,1-4H3,(H,15,16)/b9-7+,10-8-,11-6+ |
| InChIKey | IWUMQNGCJQTBHS-ZYEAKNLOSA-N |
| XLogP | 2.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|