C22H25ClN2O2S2 — CID 166695759
3-[4-[4-[2-chloro-4-(methylsulfanylamino)phenyl]thiophen-2-yl]-2-pyridinyl]-1-methoxy-2-methylbutan-2-ol (PubChem CID 166695759) has the molecular formula C22H25ClN2O2S2 and a molecular weight of 449.04 g/mol. Its IUPAC name is 3-[4-[4-[2-chloro-4-(methylsulfanylamino)phenyl]thiophen-2-yl]-2-pyridinyl]-1-methoxy-2-methylbutan-2-ol.
| Compound Name | 3-[4-[4-[2-chloro-4-(methylsulfanylamino)phenyl]thiophen-2-yl]-2-pyridinyl]-1-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 166695759 |
| Molecular Formula | C22H25ClN2O2S2 |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 3-[4-[4-[2-chloro-4-(methylsulfanylamino)phenyl]thiophen-2-yl]-2-pyridinyl]-1-methoxy-2-methylbutan-2-ol |
| SMILES | COCC(C)(O)C(C)c1cc(-c2cc(-c3ccc(NSC)cc3Cl)cs2)ccn1 |
| InChI | InChI=1S/C22H25ClN2O2S2/c1-14(22(2,26)13-27-3)20-9-15(7-8-24-20)21-10-16(12-29-21)18-6-5-17(25-28-4)11-19(18)23/h5-12,14,25-26H,13H2,1-4H3 |
| InChIKey | ZWCJVOJRDOZDLQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|