C22H24S — CID 166695909
(1E)-1-[2-[(1Z)-buta-1,3-dienyl]-3,4-bis(ethenyl)-6-methyl-5-[(Z)-prop-1-enyl]phenyl]buta-1,3-diene-2-thiol (PubChem CID 166695909) has the molecular formula C22H24S and a molecular weight of 320.50 g/mol. Its IUPAC name is (1E)-1-[2-[(1Z)-buta-1,3-dienyl]-3,4-bis(ethenyl)-6-methyl-5-[(Z)-prop-1-enyl]phenyl]buta-1,3-diene-2-thiol.
| Compound Name | (1E)-1-[2-[(1Z)-buta-1,3-dienyl]-3,4-bis(ethenyl)-6-methyl-5-[(Z)-prop-1-enyl]phenyl]buta-1,3-diene-2-thiol |
|---|---|
| PubChem CID | 166695909 |
| Molecular Formula | C22H24S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (1E)-1-[2-[(1Z)-buta-1,3-dienyl]-3,4-bis(ethenyl)-6-methyl-5-[(Z)-prop-1-enyl]phenyl]buta-1,3-diene-2-thiol |
| SMILES | C=C/C=C\c1c(C=C)c(C=C)c(/C=C\C)c(C)c1/C=C(/S)C=C |
| InChI | InChI=1S/C22H24S/c1-7-12-14-21-19(11-5)18(10-4)20(13-8-2)16(6)22(21)15-17(23)9-3/h7-15,23H,1,3-5H2,2,6H3/b13-8-,14-12-,17-15+ |
| InChIKey | BFLASHYHQNXLPI-DTLKWMOSSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|