C21H24F3N5O — CID 166695919
N'-methyl-N-[(Z)-1-[7-methyl-7-[2-methyl-4-(trifluoromethyl)phenyl]-5,6-dihydro-4H-triazolo[1,5-a]pyridin-3-yl]-3-oxoprop-1-enyl]ethanimidamide (PubChem CID 166695919) has the molecular formula C21H24F3N5O and a molecular weight of 419.45 g/mol. Its IUPAC name is N'-methyl-N-[(Z)-1-[7-methyl-7-[2-methyl-4-(trifluoromethyl)phenyl]-5,6-dihydro-4H-triazolo[1,5-a]pyridin-3-yl]-3-oxoprop-1-enyl]ethanimidamide.
| Compound Name | N'-methyl-N-[(Z)-1-[7-methyl-7-[2-methyl-4-(trifluoromethyl)phenyl]-5,6-dihydro-4H-triazolo[1,5-a]pyridin-3-yl]-3-oxoprop-1-enyl]ethanimidamide |
|---|---|
| PubChem CID | 166695919 |
| Molecular Formula | C21H24F3N5O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N'-methyl-N-[(Z)-1-[7-methyl-7-[2-methyl-4-(trifluoromethyl)phenyl]-5,6-dihydro-4H-triazolo[1,5-a]pyridin-3-yl]-3-oxoprop-1-enyl]ethanimidamide |
| SMILES | C/N=C(\C)N/C(=C\C=O)c1nnn2c1CCCC2(C)c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C21H24F3N5O/c1-13-12-15(21(22,23)24)7-8-16(13)20(3)10-5-6-18-19(27-28-29(18)20)17(9-11-30)26-14(2)25-4/h7-9,11-12H,5-6,10H2,1-4H3,(H,25,26)/b17-9- |
| InChIKey | RPNAUCHTWIELBD-MFOYZWKCSA-N |
| XLogP | 3.88 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|