C15H14N2O6 — CID 166696613
phenyl 2-oxo-2-(1,3,5-trimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)acetate (PubChem CID 166696613) has the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. Its IUPAC name is phenyl 2-oxo-2-(1,3,5-trimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)acetate.
| Compound Name | phenyl 2-oxo-2-(1,3,5-trimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)acetate |
|---|---|
| PubChem CID | 166696613 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | phenyl 2-oxo-2-(1,3,5-trimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)acetate |
| SMILES | CN1C(=O)N(C)C(=O)C(C)(C(=O)C(=O)Oc2ccccc2)C1=O |
| InChI | InChI=1S/C15H14N2O6/c1-15(12(20)16(2)14(22)17(3)13(15)21)10(18)11(19)23-9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | GLNXSIWOBNTFBM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|