C16H20N4O2S — CID 16669683
N-tert-butyl-2-(4,12-dimethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide (PubChem CID 16669683) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-tert-butyl-2-(4,12-dimethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide.
| Compound Name | N-tert-butyl-2-(4,12-dimethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide |
|---|---|
| PubChem CID | 16669683 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-tert-butyl-2-(4,12-dimethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)acetamide |
| SMILES | Cc1cc2c(cc3c(=O)n(CC(=O)NC(C)(C)C)nc(C)n32)s1 |
| InChI | InChI=1S/C16H20N4O2S/c1-9-6-11-13(23-9)7-12-15(22)19(18-10(2)20(11)12)8-14(21)17-16(3,4)5/h6-7H,8H2,1-5H3,(H,17,21) |
| InChIKey | UWCHFUHDQRVUIO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |