About 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine
4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine (PubChem CID 166696956) has the molecular formula C17H33FN2O
and a molecular weight of 300.46 g/mol. Its IUPAC name is 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine |
| PubChem CID | 166696956 |
| Molecular Formula | C17H33FN2O |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine |
| SMILES | CC(C)(C)[C@@H]1C[C@](F)(CN2CCOCC2)CN1C(C)(C)C |
| InChI | InChI=1S/C17H33FN2O/c1-15(2,3)14-11-17(18,13-20(14)16(4,5)6)12-19-7-9-21-10-8-19/h14H,7-13H2,1-6H3/t14-,17-/m0/s1 |
| InChIKey | QSQQIWNXNDAKTD-YOEHRIQHSA-N |
| XLogP | 2.95 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine?
The IUPAC name of 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine (CID 166696956) is 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine.
What is the SMILES notation for 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine?
The canonical SMILES for 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine is CC(C)(C)[C@@H]1C[C@](F)(CN2CCOCC2)CN1C(C)(C)C.
What is the InChIKey of 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine?
The InChIKey is QSQQIWNXNDAKTD-YOEHRIQHSA-N. The full InChI is InChI=1S/C17H33FN2O/c1-15(2,3)14-11-17(18,13-20(14)16(4,5)6)12-19-7-9-21-10-8-19/h14H,7-13H2,1-6H3/t14-,17-/m0/s1.
What are the key properties of 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine?
4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine has a molecular weight of 300.46 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3S,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-3-yl]methyl]morpholine is sourced from PubChem (CID 166696956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).