About (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine
(2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine (PubChem CID 166696989) has the molecular formula C6H12F3NS
and a molecular weight of 187.23 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine.
Molecular Properties
| Compound Name | (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine |
| PubChem CID | 166696989 |
| Molecular Formula | C6H12F3NS |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine |
| SMILES | CSC(C)N[C@@H](C)C(F)(F)F |
| InChI | InChI=1S/C6H12F3NS/c1-4(6(7,8)9)10-5(2)11-3/h4-5,10H,1-3H3/t4-,5?/m0/s1 |
| InChIKey | IYMJWNUUISQFCC-ROLXFIACSA-N |
| XLogP | 2.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine?
The IUPAC name of (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine (CID 166696989) is (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine.
What is the SMILES notation for (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine?
The canonical SMILES for (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine is CSC(C)N[C@@H](C)C(F)(F)F.
What is the InChIKey of (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine?
The InChIKey is IYMJWNUUISQFCC-ROLXFIACSA-N. The full InChI is InChI=1S/C6H12F3NS/c1-4(6(7,8)9)10-5(2)11-3/h4-5,10H,1-3H3/t4-,5?/m0/s1.
What are the key properties of (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine?
(2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine has a molecular weight of 187.23 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1,1-trifluoro-N-(1-methylsulfanylethyl)propan-2-amine is sourced from PubChem (CID 166696989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).