C14H26O6 — CID 166697104
2-[5-[5-(2-oxoethoxy)pentoxy]pentoxy]acetic acid (PubChem CID 166697104) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[5-[5-(2-oxoethoxy)pentoxy]pentoxy]acetic acid.
| Compound Name | 2-[5-[5-(2-oxoethoxy)pentoxy]pentoxy]acetic acid |
|---|---|
| PubChem CID | 166697104 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[5-[5-(2-oxoethoxy)pentoxy]pentoxy]acetic acid |
| SMILES | O=CCOCCCCCOCCCCCOCC(=O)O |
| InChI | InChI=1S/C14H26O6/c15-7-12-19-10-5-1-3-8-18-9-4-2-6-11-20-13-14(16)17/h7H,1-6,8-13H2,(H,16,17) |
| InChIKey | PYYAKDMKWSTXHJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|