C31H36BrN3O3 — CID 166697616
(10R,15S)-4-bromo-10-(3-hydroxyphenyl)-15-methyl-13-(4-methylidenedecyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 166697616) has the molecular formula C31H36BrN3O3 and a molecular weight of 578.55 g/mol. Its IUPAC name is (10R,15S)-4-bromo-10-(3-hydroxyphenyl)-15-methyl-13-(4-methylidenedecyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | (10R,15S)-4-bromo-10-(3-hydroxyphenyl)-15-methyl-13-(4-methylidenedecyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 166697616 |
| Molecular Formula | C31H36BrN3O3 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | (10R,15S)-4-bromo-10-(3-hydroxyphenyl)-15-methyl-13-(4-methylidenedecyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | C=C(CCCCCC)CCCN1C(=O)N2[C@H](c3cccc(O)c3)c3[nH]c4ccc(Br)cc4c3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C31H36BrN3O3/c1-4-5-6-7-10-20(2)11-9-16-34-29(37)31(3)19-25-24-18-22(32)14-15-26(24)33-27(25)28(35(31)30(34)38)21-12-8-13-23(36)17-21/h8,12-15,17-18,28,33,36H,2,4-7,9-11,16,19H2,1,3H3/t28-,31+/m1/s1 |
| InChIKey | ZKSDJDCRJRIKTM-MVSFAKPFSA-N |
| XLogP | 7.61 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|