C13H29NO5 — CID 166697705
2-[[2-(hexylamino)-2-hydroxyethoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 166697705) has the molecular formula C13H29NO5 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[[2-(hexylamino)-2-hydroxyethoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[[2-(hexylamino)-2-hydroxyethoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 166697705 |
| Molecular Formula | C13H29NO5 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2-[[2-(hexylamino)-2-hydroxyethoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCCCCCNC(O)COCC(CO)(CO)CO |
| InChI | InChI=1S/C13H29NO5/c1-2-3-4-5-6-14-12(18)7-19-11-13(8-15,9-16)10-17/h12,14-18H,2-11H2,1H3 |
| InChIKey | QSWGRPKNPUDYHI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|